About methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane
methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane (PubChem CID 173100020) has the molecular formula C4H9F3OSi2
and a molecular weight of 186.28 g/mol. Its IUPAC name is methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane.
Molecular Properties
| Compound Name | methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane |
| PubChem CID | 173100020 |
| Molecular Formula | C4H9F3OSi2 |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane |
| SMILES | C=C(F)C(F)(F)[SiH](C)O[SiH3] |
| InChI | InChI=1S/C4H9F3OSi2/c1-3(5)4(6,7)10(2)8-9/h10H,1H2,2,9H3 |
| InChIKey | PBTIOLISXFFVGW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane?
The IUPAC name of methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane (CID 173100020) is methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane.
What is the SMILES notation for methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane?
The canonical SMILES for methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane is C=C(F)C(F)(F)[SiH](C)O[SiH3].
What is the InChIKey of methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane?
The InChIKey is PBTIOLISXFFVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F3OSi2/c1-3(5)4(6,7)10(2)8-9/h10H,1H2,2,9H3.
What are the key properties of methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane?
methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane has a molecular weight of 186.28 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-silyloxy-(1,1,2-trifluoroprop-2-enyl)silane is sourced from PubChem (CID 173100020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).