C23H26FN7O — CID 173100067
3-[1-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]ethenylamino]-2-morpholin-4-ylbut-2-enimidamide (PubChem CID 173100067) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is 3-[1-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]ethenylamino]-2-morpholin-4-ylbut-2-enimidamide.
| Compound Name | 3-[1-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]ethenylamino]-2-morpholin-4-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 173100067 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-[1-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]ethenylamino]-2-morpholin-4-ylbut-2-enimidamide |
| SMILES | [H]/N=C(\N)C(=C(C)NC(=C)c1nn(Cc2ccccc2F)c2ncccc12)N1CCOCC1 |
| InChI | InChI=1S/C23H26FN7O/c1-15(28-16(2)21(22(25)26)30-10-12-32-13-11-30)20-18-7-5-9-27-23(18)31(29-20)14-17-6-3-4-8-19(17)24/h3-9,28H,1,10-14H2,2H3,(H3,25,26) |
| InChIKey | PPSDBNFPAZNNRK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|