About 2-(chloromethyl)-1,2-dihydroquinoxaline
2-(chloromethyl)-1,2-dihydroquinoxaline (PubChem CID 173100773) has the molecular formula C9H9ClN2
and a molecular weight of 180.64 g/mol. Its IUPAC name is 2-(chloromethyl)-1,2-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,2-dihydroquinoxaline |
| PubChem CID | 173100773 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(chloromethyl)-1,2-dihydroquinoxaline |
| SMILES | ClCC1C=Nc2ccccc2N1 |
| InChI | InChI=1S/C9H9ClN2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,6-7,12H,5H2 |
| InChIKey | VWLLHZSARQXBIY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,2-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,2-dihydroquinoxaline?
The IUPAC name of 2-(chloromethyl)-1,2-dihydroquinoxaline (CID 173100773) is 2-(chloromethyl)-1,2-dihydroquinoxaline.
What is the SMILES notation for 2-(chloromethyl)-1,2-dihydroquinoxaline?
The canonical SMILES for 2-(chloromethyl)-1,2-dihydroquinoxaline is ClCC1C=Nc2ccccc2N1.
What is the InChIKey of 2-(chloromethyl)-1,2-dihydroquinoxaline?
The InChIKey is VWLLHZSARQXBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,6-7,12H,5H2.
What are the key properties of 2-(chloromethyl)-1,2-dihydroquinoxaline?
2-(chloromethyl)-1,2-dihydroquinoxaline has a molecular weight of 180.64 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,2-dihydroquinoxaline is sourced from PubChem (CID 173100773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).