About 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide
2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide (PubChem CID 173100919) has the molecular formula C6H8N2O3S2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 173100919 |
| Molecular Formula | C6H8N2O3S2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide |
| SMILES | CS(=O)(=O)c1ncc(CC(N)=O)s1 |
| InChI | InChI=1S/C6H8N2O3S2/c1-13(10,11)6-8-3-4(12-6)2-5(7)9/h3H,2H2,1H3,(H2,7,9) |
| InChIKey | BYSZNSMHVJVOMT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide?
The IUPAC name of 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide (CID 173100919) is 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide is CS(=O)(=O)c1ncc(CC(N)=O)s1.
What is the InChIKey of 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide?
The InChIKey is BYSZNSMHVJVOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S2/c1-13(10,11)6-8-3-4(12-6)2-5(7)9/h3H,2H2,1H3,(H2,7,9).
What are the key properties of 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide?
2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide has a molecular weight of 220.27 g/mol, XLogP of -0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfonyl-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 173100919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).