C17H20N2O5S2 — CID 17310169
3-(benzenesulfonyl)-N-[4-(ethylsulfamoyl)phenyl]propanamide (PubChem CID 17310169) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[4-(ethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[4-(ethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17310169 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[4-(ethylsulfamoyl)phenyl]propanamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=O)CCS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-2-18-26(23,24)16-10-8-14(9-11-16)19-17(20)12-13-25(21,22)15-6-4-3-5-7-15/h3-11,18H,2,12-13H2,1H3,(H,19,20) |
| InChIKey | ODUMXISQJYJGLB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |