About 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine
3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine (PubChem CID 173102072) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine.
Molecular Properties
| Compound Name | 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine |
| PubChem CID | 173102072 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine |
| SMILES | CC1C=C(Nc2ccccc2)N=C(N)N1C |
| InChI | InChI=1S/C12H16N4/c1-9-8-11(15-12(13)16(9)2)14-10-6-4-3-5-7-10/h3-9,14H,1-2H3,(H2,13,15) |
| InChIKey | QBNLWBSRUNXUPR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine?
The IUPAC name of 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine (CID 173102072) is 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine.
What is the SMILES notation for 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine?
The canonical SMILES for 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine is CC1C=C(Nc2ccccc2)N=C(N)N1C.
What is the InChIKey of 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine?
The InChIKey is QBNLWBSRUNXUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-9-8-11(15-12(13)16(9)2)14-10-6-4-3-5-7-10/h3-9,14H,1-2H3,(H2,13,15).
What are the key properties of 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine?
3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine has a molecular weight of 216.29 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-6-N-phenyl-4H-pyrimidine-2,6-diamine is sourced from PubChem (CID 173102072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).