C20H28 — CID 173102404
(2-cyclohexa-1,3-dien-1-ylcyclohexa-2,5-dien-1-yl)cyclooctane (PubChem CID 173102404) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is (2-cyclohexa-1,3-dien-1-ylcyclohexa-2,5-dien-1-yl)cyclooctane.
| Compound Name | (2-cyclohexa-1,3-dien-1-ylcyclohexa-2,5-dien-1-yl)cyclooctane |
|---|---|
| PubChem CID | 173102404 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (2-cyclohexa-1,3-dien-1-ylcyclohexa-2,5-dien-1-yl)cyclooctane |
| SMILES | C1=CCCC(C2=CCC=CC2C2CCCCCCC2)=C1 |
| InChI | InChI=1S/C20H28/c1-2-5-11-17(12-6-3-1)19-15-9-10-16-20(19)18-13-7-4-8-14-18/h4,7,9,13,15-17,19H,1-3,5-6,8,10-12,14H2 |
| InChIKey | IGUSURLGWBCKEM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|