C10H17N5O — CID 173102818
1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl(pyrrolidin-1-yl)methanone (PubChem CID 173102818) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl(pyrrolidin-1-yl)methanone.
| Compound Name | 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl(pyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 173102818 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl(pyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CN2C=NNC2CN1)N1CCCC1 |
| InChI | InChI=1S/C10H17N5O/c16-10(14-3-1-2-4-14)8-6-15-7-12-13-9(15)5-11-8/h7-9,11,13H,1-6H2 |
| InChIKey | SUYHQJTWWLELOQ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |