C11H20N6O — CID 173103117
1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl-(2-methylpiperazin-1-yl)methanone (PubChem CID 173103117) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl-(2-methylpiperazin-1-yl)methanone.
| Compound Name | 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl-(2-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 173103117 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[4,3-a]pyrazin-6-yl-(2-methylpiperazin-1-yl)methanone |
| SMILES | CC1CNCCN1C(=O)C1CN2C=NNC2CN1 |
| InChI | InChI=1S/C11H20N6O/c1-8-4-12-2-3-17(8)11(18)9-6-16-7-14-15-10(16)5-13-9/h7-10,12-13,15H,2-6H2,1H3 |
| InChIKey | RVCQXUVRWQSTMZ-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |