C35H58O6Si — CID 173103631
7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-13-methylidene-1,2,2-tri(propan-2-yl)-11-silyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 173103631) has the molecular formula C35H58O6Si and a molecular weight of 602.93 g/mol. Its IUPAC name is 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-13-methylidene-1,2,2-tri(propan-2-yl)-11-silyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-13-methylidene-1,2,2-tri(propan-2-yl)-11-silyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 173103631 |
| Molecular Formula | C35H58O6Si |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-15-methyl-13-methylidene-1,2,2-tri(propan-2-yl)-11-silyloxy-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CC(C)CC2CC=CC(C(C)C)(O2)C(C(C)C)(C(C)C)C=CC(=O)OC(C2COC(C)(C)O2)CC=CC(O[SiH3])C1 |
| InChI | InChI=1S/C35H58O6Si/c1-23(2)34(24(3)4)18-16-32(36)38-30(31-22-37-33(9,10)40-31)15-11-13-29(41-42)21-27(8)19-26(7)20-28-14-12-17-35(34,39-28)25(5)6/h11-13,16-18,23-26,28-31H,8,14-15,19-22H2,1-7,9-10,42H3 |
| InChIKey | NHBNIDHFKJEUDY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|