C8H16ClN — CID 173103808
(1R,2S,6S)-2-chloro-4,6-dimethylcyclohexan-1-amine (PubChem CID 173103808) has the molecular formula C8H16ClN and a molecular weight of 161.68 g/mol. Its IUPAC name is (1R,2S,6S)-2-chloro-4,6-dimethylcyclohexan-1-amine.
| Compound Name | (1R,2S,6S)-2-chloro-4,6-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 173103808 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (1R,2S,6S)-2-chloro-4,6-dimethylcyclohexan-1-amine |
| SMILES | CC1C[C@H](C)[C@@H](N)[C@@H](Cl)C1 |
| InChI | InChI=1S/C8H16ClN/c1-5-3-6(2)8(10)7(9)4-5/h5-8H,3-4,10H2,1-2H3/t5?,6-,7-,8+/m0/s1 |
| InChIKey | WSHQFVPZMLVASQ-DDQKOSFYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|