About sodium;hydride;1H-imidazol-2-yl acetate
sodium;hydride;1H-imidazol-2-yl acetate (PubChem CID 173104751) has the molecular formula C5H7N2NaO2
and a molecular weight of 150.11 g/mol. Its IUPAC name is sodium;hydride;1H-imidazol-2-yl acetate.
Molecular Properties
| Compound Name | sodium;hydride;1H-imidazol-2-yl acetate |
| PubChem CID | 173104751 |
| Molecular Formula | C5H7N2NaO2 |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | sodium;hydride;1H-imidazol-2-yl acetate |
| SMILES | CC(=O)Oc1ncc[nH]1.[H-].[Na+] |
| InChI | InChI=1S/C5H6N2O2.Na.H/c1-4(8)9-5-6-2-3-7-5;;/h2-3H,1H3,(H,6,7);;/q;+1;-1 |
| InChIKey | XGYOIOGJLBOHDA-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;hydride;1H-imidazol-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1H-imidazol-2-yl acetate?
The IUPAC name of sodium;hydride;1H-imidazol-2-yl acetate (CID 173104751) is sodium;hydride;1H-imidazol-2-yl acetate.
What is the SMILES notation for sodium;hydride;1H-imidazol-2-yl acetate?
The canonical SMILES for sodium;hydride;1H-imidazol-2-yl acetate is CC(=O)Oc1ncc[nH]1.[H-].[Na+].
What is the InChIKey of sodium;hydride;1H-imidazol-2-yl acetate?
The InChIKey is XGYOIOGJLBOHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.Na.H/c1-4(8)9-5-6-2-3-7-5;;/h2-3H,1H3,(H,6,7);;/q;+1;-1.
What are the key properties of sodium;hydride;1H-imidazol-2-yl acetate?
sodium;hydride;1H-imidazol-2-yl acetate has a molecular weight of 150.11 g/mol, XLogP of -2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1H-imidazol-2-yl acetate is sourced from PubChem (CID 173104751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).