C17H14O10S — CID 173104909
[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] sulfate;hydron (PubChem CID 173104909) has the molecular formula C17H14O10S and a molecular weight of 410.36 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] sulfate;hydron.
| Compound Name | [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] sulfate;hydron |
|---|---|
| PubChem CID | 173104909 |
| Molecular Formula | C17H14O10S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] sulfate;hydron |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OS(=O)(=O)[O-])cc1OC.[H+] |
| InChI | InChI=1S/C17H14O10S/c1-24-11-4-3-8(5-12(11)25-2)16-17(27-28(21,22)23)15(20)14-10(19)6-9(18)7-13(14)26-16/h3-7,18-19H,1-2H3,(H,21,22,23) |
| InChIKey | ZETIGGMQUDKYJK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|