About 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide
1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide (PubChem CID 173105280) has the molecular formula C21H24N2O2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide |
| PubChem CID | 173105280 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide |
| SMILES | CC(=O)N1c2ccccc2C(C)(c2ccccc2)C(C(N)=O)C1(C)C |
| InChI | InChI=1S/C21H24N2O2/c1-14(24)23-17-13-9-8-12-16(17)21(4,15-10-6-5-7-11-15)18(19(22)25)20(23,2)3/h5-13,18H,1-4H3,(H2,22,25) |
| InChIKey | MYUNBTFLCNFAJS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide?
The IUPAC name of 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide (CID 173105280) is 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide.
What is the SMILES notation for 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide?
The canonical SMILES for 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide is CC(=O)N1c2ccccc2C(C)(c2ccccc2)C(C(N)=O)C1(C)C.
What is the InChIKey of 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide?
The InChIKey is MYUNBTFLCNFAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2/c1-14(24)23-17-13-9-8-12-16(17)21(4,15-10-6-5-7-11-15)18(19(22)25)20(23,2)3/h5-13,18H,1-4H3,(H2,22,25).
What are the key properties of 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide?
1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide has a molecular weight of 336.44 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2,2,4-trimethyl-4-phenyl-3H-quinoline-3-carboxamide is sourced from PubChem (CID 173105280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).