C21H40O4Si2 — CID 173105493
1,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 173105493) has the molecular formula C21H40O4Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is 1,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 1,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 173105493 |
| Molecular Formula | C21H40O4Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[SiH](C)OC(C(C)(C)C)C12C=CC(C(O[SiH](C)C)C(C)(C)C)(CC(=O)C1)O2 |
| InChI | InChI=1S/C21H40O4Si2/c1-18(2,3)16(23-26(7)8)20-11-12-21(25-20,14-15(22)13-20)17(19(4,5)6)24-27(9)10/h11-12,16-17,26-27H,13-14H2,1-10H3 |
| InChIKey | OBPIVFOBBZNXMN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|