About [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate
[2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate (PubChem CID 173105551) has the molecular formula C23H22FN3O3S
and a molecular weight of 439.51 g/mol. Its IUPAC name is [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate.
Molecular Properties
| Compound Name | [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate |
| PubChem CID | 173105551 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate |
| SMILES | NC(=O)Oc1ccccc1-c1nc(C(=O)CC2CCCCN2)c(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C23H22FN3O3S/c24-15-10-8-14(9-11-15)21-20(18(28)13-16-5-3-4-12-26-16)27-22(31-21)17-6-1-2-7-19(17)30-23(25)29/h1-2,6-11,16,26H,3-5,12-13H2,(H2,25,29) |
| InChIKey | GWZKBUDIIJCIIX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate?
The IUPAC name of [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate (CID 173105551) is [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate.
What is the SMILES notation for [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate?
The canonical SMILES for [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate is NC(=O)Oc1ccccc1-c1nc(C(=O)CC2CCCCN2)c(-c2ccc(F)cc2)s1.
What is the InChIKey of [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate?
The InChIKey is GWZKBUDIIJCIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FN3O3S/c24-15-10-8-14(9-11-15)21-20(18(28)13-16-5-3-4-12-26-16)27-22(31-21)17-6-1-2-7-19(17)30-23(25)29/h1-2,6-11,16,26H,3-5,12-13H2,(H2,25,29).
What are the key properties of [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate?
[2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate has a molecular weight of 439.51 g/mol, XLogP of 4.79, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-(4-fluorophenyl)-4-(2-piperidin-2-ylacetyl)-1,3-thiazol-2-yl]phenyl] carbamate is sourced from PubChem (CID 173105551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).