C14H19F3O — CID 173105565
1,1,1-trifluoro-2,4-dimethyl-4-phenylhexan-2-ol (PubChem CID 173105565) has the molecular formula C14H19F3O and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,4-dimethyl-4-phenylhexan-2-ol.
| Compound Name | 1,1,1-trifluoro-2,4-dimethyl-4-phenylhexan-2-ol |
|---|---|
| PubChem CID | 173105565 |
| Molecular Formula | C14H19F3O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1,1,1-trifluoro-2,4-dimethyl-4-phenylhexan-2-ol |
| SMILES | CCC(C)(CC(C)(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H19F3O/c1-4-12(2,11-8-6-5-7-9-11)10-13(3,18)14(15,16)17/h5-9,18H,4,10H2,1-3H3 |
| InChIKey | WKLBSLAQNQRXTC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |