About 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol
4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol (PubChem CID 173106082) has the molecular formula C10H24OS3Si
and a molecular weight of 284.59 g/mol. Its IUPAC name is 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol.
Molecular Properties
| Compound Name | 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol |
| PubChem CID | 173106082 |
| Molecular Formula | C10H24OS3Si |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol |
| SMILES | CCC(S)C(O[SiH3])(C(S)CC)C(S)CC |
| InChI | InChI=1S/C10H24OS3Si/c1-4-7(12)10(11-15,8(13)5-2)9(14)6-3/h7-9,12-14H,4-6H2,1-3,15H3 |
| InChIKey | QAOWNFVTYAMNMT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol?
The IUPAC name of 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol (CID 173106082) is 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol.
What is the SMILES notation for 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol?
The canonical SMILES for 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol is CCC(S)C(O[SiH3])(C(S)CC)C(S)CC.
What is the InChIKey of 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol?
The InChIKey is QAOWNFVTYAMNMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24OS3Si/c1-4-7(12)10(11-15,8(13)5-2)9(14)6-3/h7-9,12-14H,4-6H2,1-3,15H3.
What are the key properties of 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol?
4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol has a molecular weight of 284.59 g/mol, XLogP of 2.15, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-silyloxy-4-(1-sulfanylpropyl)heptane-3,5-dithiol is sourced from PubChem (CID 173106082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).