C28H50OSi2 — CID 173106303
(5-tert-butyl-6-methoxy-1,2,3-trimethyl-4-methylsilylcyclohexa-2,4-dien-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 173106303) has the molecular formula C28H50OSi2 and a molecular weight of 458.88 g/mol. Its IUPAC name is (5-tert-butyl-6-methoxy-1,2,3-trimethyl-4-methylsilylcyclohexa-2,4-dien-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (5-tert-butyl-6-methoxy-1,2,3-trimethyl-4-methylsilylcyclohexa-2,4-dien-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 173106303 |
| Molecular Formula | C28H50OSi2 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (5-tert-butyl-6-methoxy-1,2,3-trimethyl-4-methylsilylcyclohexa-2,4-dien-1-yl)-diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC[Si](CC)(C1=C(C)C(C)=C(C)C1C)C1(C)C(C)=C(C)C([SiH2]C)=C(C(C)(C)C)C1OC |
| InChI | InChI=1S/C28H50OSi2/c1-15-31(16-2,25-19(5)17(3)18(4)20(25)6)28(12)22(8)21(7)24(30-14)23(26(28)29-13)27(9,10)11/h19,26H,15-16,30H2,1-14H3 |
| InChIKey | YBARCOCQSDQLEB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|