About 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol
3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol (PubChem CID 173106341) has the molecular formula C7H18OS3Si
and a molecular weight of 242.51 g/mol. Its IUPAC name is 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol.
Molecular Properties
| Compound Name | 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol |
| PubChem CID | 173106341 |
| Molecular Formula | C7H18OS3Si |
| Molecular Weight | 242.51 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol |
| SMILES | CC(S)C(O[SiH3])(C(C)S)C(C)S |
| InChI | InChI=1S/C7H18OS3Si/c1-4(9)7(8-12,5(2)10)6(3)11/h4-6,9-11H,1-3,12H3 |
| InChIKey | MMDPFBMLRRYEBQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.51 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol?
The IUPAC name of 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol (CID 173106341) is 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol.
What is the SMILES notation for 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol?
The canonical SMILES for 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol is CC(S)C(O[SiH3])(C(C)S)C(C)S.
What is the InChIKey of 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol?
The InChIKey is MMDPFBMLRRYEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18OS3Si/c1-4(9)7(8-12,5(2)10)6(3)11/h4-6,9-11H,1-3,12H3.
What are the key properties of 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol?
3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol has a molecular weight of 242.51 g/mol, XLogP of 0.98, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-silyloxy-3-(1-sulfanylethyl)pentane-2,4-dithiol is sourced from PubChem (CID 173106341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).