C22H22FN3O2 — CID 17310667
1-(4-fluorophenyl)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17310667) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17310667 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc2[nH]cc(CCNC(=O)C3CC(=O)N(c4ccc(F)cc4)C3)c2c1 |
| InChI | InChI=1S/C22H22FN3O2/c1-14-2-7-20-19(10-14)15(12-25-20)8-9-24-22(28)16-11-21(27)26(13-16)18-5-3-17(23)4-6-18/h2-7,10,12,16,25H,8-9,11,13H2,1H3,(H,24,28) |
| InChIKey | OSXBKCOSDJJZMU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |