About N,N-dimethylformamide;hydron;chloride
N,N-dimethylformamide;hydron;chloride (PubChem CID 173106817) has the molecular formula C3H8ClNO
and a molecular weight of 109.56 g/mol. Its IUPAC name is N,N-dimethylformamide;hydron;chloride.
Molecular Properties
| Compound Name | N,N-dimethylformamide;hydron;chloride |
| PubChem CID | 173106817 |
| Molecular Formula | C3H8ClNO |
| Molecular Weight | 109.56 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | N,N-dimethylformamide;hydron;chloride |
| SMILES | CN(C)C=O.[Cl-].[H+] |
| InChI | InChI=1S/C3H7NO.ClH/c1-4(2)3-5;/h3H,1-2H3;1H |
| InChIKey | SAVROPQJUYSBDD-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.56 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;hydron;chloride?
The IUPAC name of N,N-dimethylformamide;hydron;chloride (CID 173106817) is N,N-dimethylformamide;hydron;chloride.
What is the SMILES notation for N,N-dimethylformamide;hydron;chloride?
The canonical SMILES for N,N-dimethylformamide;hydron;chloride is CN(C)C=O.[Cl-].[H+].
What is the InChIKey of N,N-dimethylformamide;hydron;chloride?
The InChIKey is SAVROPQJUYSBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.ClH/c1-4(2)3-5;/h3H,1-2H3;1H.
What are the key properties of N,N-dimethylformamide;hydron;chloride?
N,N-dimethylformamide;hydron;chloride has a molecular weight of 109.56 g/mol, XLogP of -3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;hydron;chloride is sourced from PubChem (CID 173106817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).