About hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid
hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid (PubChem CID 173107070) has the molecular formula C8H18N2O7S2
and a molecular weight of 318.37 g/mol. Its IUPAC name is hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid.
Molecular Properties
| Compound Name | hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid |
| PubChem CID | 173107070 |
| Molecular Formula | C8H18N2O7S2 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid |
| SMILES | CN1C=CN(CCCCS(=O)(=O)O)C1.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C8H16N2O3S.H2O4S/c1-9-5-6-10(8-9)4-2-3-7-14(11,12)13;1-5(2,3)4/h5-6H,2-4,7-8H2,1H3,(H,11,12,13);(H2,1,2,3,4) |
| InChIKey | GCWKVWDYJOZIKH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid?
The IUPAC name of hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid (CID 173107070) is hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid.
What is the SMILES notation for hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid?
The canonical SMILES for hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid is CN1C=CN(CCCCS(=O)(=O)O)C1.O=S(=O)([O-])O.[H+].
What is the InChIKey of hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid?
The InChIKey is GCWKVWDYJOZIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3S.H2O4S/c1-9-5-6-10(8-9)4-2-3-7-14(11,12)13;1-5(2,3)4/h5-6H,2-4,7-8H2,1H3,(H,11,12,13);(H2,1,2,3,4).
What are the key properties of hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid?
hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid has a molecular weight of 318.37 g/mol, XLogP of -0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;hydron;4-(3-methyl-2H-imidazol-1-yl)butane-1-sulfonic acid is sourced from PubChem (CID 173107070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).