About 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane
1-(azetidin-3-yl)ethanamine;diethoxymethylsilane (PubChem CID 173107228) has the molecular formula C10H26N2O2Si
and a molecular weight of 234.42 g/mol. Its IUPAC name is 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane |
| PubChem CID | 173107228 |
| Molecular Formula | C10H26N2O2Si |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane |
| SMILES | CC(N)C1CNC1.CCOC([SiH3])OCC |
| InChI | InChI=1S/C5H12N2.C5H14O2Si/c1-4(6)5-2-7-3-5;1-3-6-5(8)7-4-2/h4-5,7H,2-3,6H2,1H3;5H,3-4H2,1-2,8H3 |
| InChIKey | KZRYHTPLDUSZPM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane?
The IUPAC name of 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane (CID 173107228) is 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane.
What is the SMILES notation for 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane?
The canonical SMILES for 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane is CC(N)C1CNC1.CCOC([SiH3])OCC.
What is the InChIKey of 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane?
The InChIKey is KZRYHTPLDUSZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C5H14O2Si/c1-4(6)5-2-7-3-5;1-3-6-5(8)7-4-2/h4-5,7H,2-3,6H2,1H3;5H,3-4H2,1-2,8H3.
What are the key properties of 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane?
1-(azetidin-3-yl)ethanamine;diethoxymethylsilane has a molecular weight of 234.42 g/mol, XLogP of -0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)ethanamine;diethoxymethylsilane is sourced from PubChem (CID 173107228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).