About magnesium;1-chloro-4-ethenylbenzene;hydride
magnesium;1-chloro-4-ethenylbenzene;hydride (PubChem CID 173109944) has the molecular formula C8H9ClMg
and a molecular weight of 164.92 g/mol. Its IUPAC name is magnesium;1-chloro-4-ethenylbenzene;hydride.
Molecular Properties
| Compound Name | magnesium;1-chloro-4-ethenylbenzene;hydride |
| PubChem CID | 173109944 |
| Molecular Formula | C8H9ClMg |
| Molecular Weight | 164.92 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | magnesium;1-chloro-4-ethenylbenzene;hydride |
| SMILES | C=Cc1ccc(Cl)cc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C8H7Cl.Mg.2H/c1-2-7-3-5-8(9)6-4-7;;;/h2-6H,1H2;;;/q;+2;2*-1 |
| InChIKey | HKNCSODSUCOFQH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;1-chloro-4-ethenylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-chloro-4-ethenylbenzene;hydride?
The IUPAC name of magnesium;1-chloro-4-ethenylbenzene;hydride (CID 173109944) is magnesium;1-chloro-4-ethenylbenzene;hydride.
What is the SMILES notation for magnesium;1-chloro-4-ethenylbenzene;hydride?
The canonical SMILES for magnesium;1-chloro-4-ethenylbenzene;hydride is C=Cc1ccc(Cl)cc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;1-chloro-4-ethenylbenzene;hydride?
The InChIKey is HKNCSODSUCOFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl.Mg.2H/c1-2-7-3-5-8(9)6-4-7;;;/h2-6H,1H2;;;/q;+2;2*-1.
What are the key properties of magnesium;1-chloro-4-ethenylbenzene;hydride?
magnesium;1-chloro-4-ethenylbenzene;hydride has a molecular weight of 164.92 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-chloro-4-ethenylbenzene;hydride is sourced from PubChem (CID 173109944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).