C19H26FNO5 — CID 173109967
5-[4-[1-(4-fluorophenyl)ethylideneamino]oxybutyl]-2,4-dimethyl-1,3-dioxane-2-carboxylic acid (PubChem CID 173109967) has the molecular formula C19H26FNO5 and a molecular weight of 367.42 g/mol. Its IUPAC name is 5-[4-[1-(4-fluorophenyl)ethylideneamino]oxybutyl]-2,4-dimethyl-1,3-dioxane-2-carboxylic acid.
| Compound Name | 5-[4-[1-(4-fluorophenyl)ethylideneamino]oxybutyl]-2,4-dimethyl-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 173109967 |
| Molecular Formula | C19H26FNO5 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-[4-[1-(4-fluorophenyl)ethylideneamino]oxybutyl]-2,4-dimethyl-1,3-dioxane-2-carboxylic acid |
| SMILES | CC(=NOCCCCC1COC(C)(C(=O)O)OC1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FNO5/c1-13(15-7-9-17(20)10-8-15)21-25-11-5-4-6-16-12-24-19(3,18(22)23)26-14(16)2/h7-10,14,16H,4-6,11-12H2,1-3H3,(H,22,23) |
| InChIKey | UKGGBSRQAQQYSE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|