C6H11Cl7Si2 — CID 173110050
chloro(silyl)silane;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 173110050) has the molecular formula C6H11Cl7Si2 and a molecular weight of 387.50 g/mol. Its IUPAC name is chloro(silyl)silane;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | chloro(silyl)silane;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 173110050 |
| Molecular Formula | C6H11Cl7Si2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 383.82 |
| IUPAC Name | chloro(silyl)silane;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.[SiH3][SiH2]Cl |
| InChI | InChI=1S/C6H6Cl6.ClH5Si2/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-3-2/h1-6H;3H2,2H3 |
| InChIKey | DSEXNAFHTIKYFE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|