About 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine
1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine (PubChem CID 173111212) has the molecular formula C21H17N7
and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine.
Molecular Properties
| Compound Name | 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine |
| PubChem CID | 173111212 |
| Molecular Formula | C21H17N7 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine |
| SMILES | [H]/N=C(\N)N=C1C=C2/C=c3/cc/c([nH]3)=C/c3ccc([nH]3)/C=C3/C=CC(=N3)/C=C/1N2 |
| InChI | InChI=1S/C21H17N7/c22-21(23)28-20-11-18-9-16-4-3-14(25-16)7-12-1-2-13(24-12)8-15-5-6-17(26-15)10-19(20)27-18/h1-11,24-25,27H,(H3,22,23)/b14-7-,15-8-,16-9-,19-10-,28-20? |
| InChIKey | BMRNLZXVKIMFSP-CIFBFORGSA-N |
| XLogP | 1.02 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine?
The IUPAC name of 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine (CID 173111212) is 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine.
What is the SMILES notation for 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine?
The canonical SMILES for 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine is [H]/N=C(\N)N=C1C=C2/C=c3/cc/c([nH]3)=C/c3ccc([nH]3)/C=C3/C=CC(=N3)/C=C/1N2.
What is the InChIKey of 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine?
The InChIKey is BMRNLZXVKIMFSP-CIFBFORGSA-N. The full InChI is InChI=1S/C21H17N7/c22-21(23)28-20-11-18-9-16-4-3-14(25-16)7-12-1-2-13(24-12)8-15-5-6-17(26-15)10-19(20)27-18/h1-11,24-25,27H,(H3,22,23)/b14-7-,15-8-,16-9-,19-10-,28-20?.
What are the key properties of 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine?
1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine has a molecular weight of 367.42 g/mol, XLogP of 1.02, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(22,23-dihydro-21H-porphyrin-2-ylidene)guanidine is sourced from PubChem (CID 173111212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).