About 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one
4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one (PubChem CID 173111909) has the molecular formula C9H9F3O
and a molecular weight of 190.16 g/mol. Its IUPAC name is 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 173111909 |
| Molecular Formula | C9H9F3O |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC(C)C(=O)C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H9F3O/c1-5-3-6(2)8(13)7(4-5)9(10,11)12/h3-4,6H,1-2H3 |
| InChIKey | KDWONPFMEKRNNH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one (CID 173111909) is 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one is CC1=CC(C)C(=O)C(C(F)(F)F)=C1.
What is the InChIKey of 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The InChIKey is KDWONPFMEKRNNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3O/c1-5-3-6(2)8(13)7(4-5)9(10,11)12/h3-4,6H,1-2H3.
What are the key properties of 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one has a molecular weight of 190.16 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-(trifluoromethyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 173111909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).