About azane;1,2-dimethylpyrrolidine;hydroiodide
azane;1,2-dimethylpyrrolidine;hydroiodide (PubChem CID 173111970) has the molecular formula C6H17IN2
and a molecular weight of 244.12 g/mol. Its IUPAC name is azane;1,2-dimethylpyrrolidine;hydroiodide.
Molecular Properties
| Compound Name | azane;1,2-dimethylpyrrolidine;hydroiodide |
| PubChem CID | 173111970 |
| Molecular Formula | C6H17IN2 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | azane;1,2-dimethylpyrrolidine;hydroiodide |
| SMILES | CC1CCCN1C.I.N |
| InChI | InChI=1S/C6H13N.HI.H3N/c1-6-4-3-5-7(6)2;;/h6H,3-5H2,1-2H3;1H;1H3 |
| InChIKey | HVDDRHGKZYFXQE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azane;1,2-dimethylpyrrolidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-dimethylpyrrolidine;hydroiodide?
The IUPAC name of azane;1,2-dimethylpyrrolidine;hydroiodide (CID 173111970) is azane;1,2-dimethylpyrrolidine;hydroiodide.
What is the SMILES notation for azane;1,2-dimethylpyrrolidine;hydroiodide?
The canonical SMILES for azane;1,2-dimethylpyrrolidine;hydroiodide is CC1CCCN1C.I.N.
What is the InChIKey of azane;1,2-dimethylpyrrolidine;hydroiodide?
The InChIKey is HVDDRHGKZYFXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.HI.H3N/c1-6-4-3-5-7(6)2;;/h6H,3-5H2,1-2H3;1H;1H3.
What are the key properties of azane;1,2-dimethylpyrrolidine;hydroiodide?
azane;1,2-dimethylpyrrolidine;hydroiodide has a molecular weight of 244.12 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-dimethylpyrrolidine;hydroiodide is sourced from PubChem (CID 173111970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).