C17H14ClF2N3O2S — CID 173112054
2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorophenyl]-N'-hydroxypropanimidamide (PubChem CID 173112054) has the molecular formula C17H14ClF2N3O2S and a molecular weight of 397.83 g/mol. Its IUPAC name is 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorophenyl]-N'-hydroxypropanimidamide.
| Compound Name | 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorophenyl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 173112054 |
| Molecular Formula | C17H14ClF2N3O2S |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2,6-difluorophenyl]-N'-hydroxypropanimidamide |
| SMILES | CC(C(N)=NO)c1c(F)ccc(OCc2nc3cc(Cl)ccc3s2)c1F |
| InChI | InChI=1S/C17H14ClF2N3O2S/c1-8(17(21)23-24)15-10(19)3-4-12(16(15)20)25-7-14-22-11-6-9(18)2-5-13(11)26-14/h2-6,8,24H,7H2,1H3,(H2,21,23) |
| InChIKey | AYQQWDPUPXMGTM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|