About 1,2-bis(but-2-enyl)cycloocta-1,5-diene
1,2-bis(but-2-enyl)cycloocta-1,5-diene (PubChem CID 173112409) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,2-bis(but-2-enyl)cycloocta-1,5-diene.
Molecular Properties
| Compound Name | 1,2-bis(but-2-enyl)cycloocta-1,5-diene |
| PubChem CID | 173112409 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,2-bis(but-2-enyl)cycloocta-1,5-diene |
| SMILES | CC=CCC1=C(CC=CC)CCC=CCC1 |
| InChI | InChI=1S/C16H24/c1-3-5-11-15-13-9-7-8-10-14-16(15)12-6-4-2/h3-8H,9-14H2,1-2H3 |
| InChIKey | JNQUPWZITLTFDQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(but-2-enyl)cycloocta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(but-2-enyl)cycloocta-1,5-diene?
The IUPAC name of 1,2-bis(but-2-enyl)cycloocta-1,5-diene (CID 173112409) is 1,2-bis(but-2-enyl)cycloocta-1,5-diene.
What is the SMILES notation for 1,2-bis(but-2-enyl)cycloocta-1,5-diene?
The canonical SMILES for 1,2-bis(but-2-enyl)cycloocta-1,5-diene is CC=CCC1=C(CC=CC)CCC=CCC1.
What is the InChIKey of 1,2-bis(but-2-enyl)cycloocta-1,5-diene?
The InChIKey is JNQUPWZITLTFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-3-5-11-15-13-9-7-8-10-14-16(15)12-6-4-2/h3-8H,9-14H2,1-2H3.
What are the key properties of 1,2-bis(but-2-enyl)cycloocta-1,5-diene?
1,2-bis(but-2-enyl)cycloocta-1,5-diene has a molecular weight of 216.37 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(but-2-enyl)cycloocta-1,5-diene is sourced from PubChem (CID 173112409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).