About 4-ethenyloxatrisilinane
4-ethenyloxatrisilinane (PubChem CID 173112767) has the molecular formula C4H12OSi3
and a molecular weight of 160.40 g/mol. Its IUPAC name is 4-ethenyloxatrisilinane.
Molecular Properties
| Compound Name | 4-ethenyloxatrisilinane |
| PubChem CID | 173112767 |
| Molecular Formula | C4H12OSi3 |
| Molecular Weight | 160.40 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 4-ethenyloxatrisilinane |
| SMILES | C=C[SiH]1CCO[SiH2][SiH2]1 |
| InChI | InChI=1S/C4H12OSi3/c1-2-8-4-3-5-6-7-8/h2,8H,1,3-4,6-7H2 |
| InChIKey | ULEZFTZBUQBTNU-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyloxatrisilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyloxatrisilinane?
The IUPAC name of 4-ethenyloxatrisilinane (CID 173112767) is 4-ethenyloxatrisilinane.
What is the SMILES notation for 4-ethenyloxatrisilinane?
The canonical SMILES for 4-ethenyloxatrisilinane is C=C[SiH]1CCO[SiH2][SiH2]1.
What is the InChIKey of 4-ethenyloxatrisilinane?
The InChIKey is ULEZFTZBUQBTNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi3/c1-2-8-4-3-5-6-7-8/h2,8H,1,3-4,6-7H2.
What are the key properties of 4-ethenyloxatrisilinane?
4-ethenyloxatrisilinane has a molecular weight of 160.40 g/mol, XLogP of -1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyloxatrisilinane is sourced from PubChem (CID 173112767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).