C13H27NOSi — CID 173113122
(3S)-3-dimethylsilyl-3-hydroxy-2,2,6,6-tetramethylheptanenitrile (PubChem CID 173113122) has the molecular formula C13H27NOSi and a molecular weight of 241.45 g/mol. Its IUPAC name is (3S)-3-dimethylsilyl-3-hydroxy-2,2,6,6-tetramethylheptanenitrile.
| Compound Name | (3S)-3-dimethylsilyl-3-hydroxy-2,2,6,6-tetramethylheptanenitrile |
|---|---|
| PubChem CID | 173113122 |
| Molecular Formula | C13H27NOSi |
| Molecular Weight | 241.45 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | (3S)-3-dimethylsilyl-3-hydroxy-2,2,6,6-tetramethylheptanenitrile |
| SMILES | C[SiH](C)[C@@](O)(CCC(C)(C)C)C(C)(C)C#N |
| InChI | InChI=1S/C13H27NOSi/c1-11(2,3)8-9-13(15,16(6)7)12(4,5)10-14/h15-16H,8-9H2,1-7H3/t13-/m0/s1 |
| InChIKey | LEGGGKYVZQZPNN-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|