About N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine
N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine (PubChem CID 173113230) has the molecular formula C15H28N2OSi
and a molecular weight of 280.49 g/mol. Its IUPAC name is N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine.
Molecular Properties
| Compound Name | N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine |
| PubChem CID | 173113230 |
| Molecular Formula | C15H28N2OSi |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine |
| SMILES | CC(C)O[SiH2]CCC/N=C/c1ccccc1.CNC |
| InChI | InChI=1S/C13H21NOSi.C2H7N/c1-12(2)15-16-10-6-9-14-11-13-7-4-3-5-8-13;1-3-2/h3-5,7-8,11-12H,6,9-10,16H2,1-2H3;3H,1-2H3/b14-11+; |
| InChIKey | IOWVJNLSTBEWPD-JHGYPSGKSA-N |
| XLogP | 2.26 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine?
The IUPAC name of N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine (CID 173113230) is N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine.
What is the SMILES notation for N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine?
The canonical SMILES for N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine is CC(C)O[SiH2]CCC/N=C/c1ccccc1.CNC.
What is the InChIKey of N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine?
The InChIKey is IOWVJNLSTBEWPD-JHGYPSGKSA-N. The full InChI is InChI=1S/C13H21NOSi.C2H7N/c1-12(2)15-16-10-6-9-14-11-13-7-4-3-5-8-13;1-3-2/h3-5,7-8,11-12H,6,9-10,16H2,1-2H3;3H,1-2H3/b14-11+;.
What are the key properties of N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine?
N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine has a molecular weight of 280.49 g/mol, XLogP of 2.26, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;1-phenyl-N-(3-propan-2-yloxysilylpropyl)methanimine is sourced from PubChem (CID 173113230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).