C31H43NO6 — CID 173113727
(4S,7R,8S,9S,13E,16S)-7-but-3-enyl-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzoxazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 173113727) has the molecular formula C31H43NO6 and a molecular weight of 525.69 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-7-but-3-enyl-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzoxazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-7-but-3-enyl-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzoxazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 173113727 |
| Molecular Formula | C31H43NO6 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-7-but-3-enyl-4,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzoxazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C=CCC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3oc(C)nc3c2)C/C=C(\C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H43NO6/c1-7-8-12-23-29(35)20(3)11-9-10-19(2)13-15-25(22-14-16-26-24(17-22)32-21(4)37-26)38-28(34)18-27(33)31(5,6)30(23)36/h7,13-14,16-17,20,23,25,27,29,33,35H,1,8-12,15,18H2,2-6H3/b19-13+/t20-,23+,25-,27-,29-/m0/s1 |
| InChIKey | ZFDBNVNNUAAWCX-CMVFLZRJSA-N |
| XLogP | 6.17 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|