About 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide
1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide (PubChem CID 173113848) has the molecular formula C13H15Br2NOS
and a molecular weight of 393.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide |
| PubChem CID | 173113848 |
| Molecular Formula | C13H15Br2NOS |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide |
| SMILES | Br.CC1=C(C)N(CC(=O)c2ccc(Br)cc2)CS1 |
| InChI | InChI=1S/C13H14BrNOS.BrH/c1-9-10(2)17-8-15(9)7-13(16)11-3-5-12(14)6-4-11;/h3-6H,7-8H2,1-2H3;1H |
| InChIKey | ZMONYUIXULKHFJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide?
The IUPAC name of 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide (CID 173113848) is 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide.
What is the SMILES notation for 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide?
The canonical SMILES for 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide is Br.CC1=C(C)N(CC(=O)c2ccc(Br)cc2)CS1.
What is the InChIKey of 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide?
The InChIKey is ZMONYUIXULKHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNOS.BrH/c1-9-10(2)17-8-15(9)7-13(16)11-3-5-12(14)6-4-11;/h3-6H,7-8H2,1-2H3;1H.
What are the key properties of 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide?
1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide has a molecular weight of 393.14 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(4,5-dimethyl-2H-1,3-thiazol-3-yl)ethanone;hydrobromide is sourced from PubChem (CID 173113848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).