C16H11F3N4O2S — CID 173114792
6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2,2,2-trifluoroethoxy)quinoline-3-carbonitrile (PubChem CID 173114792) has the molecular formula C16H11F3N4O2S and a molecular weight of 380.35 g/mol. Its IUPAC name is 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2,2,2-trifluoroethoxy)quinoline-3-carbonitrile.
| Compound Name | 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2,2,2-trifluoroethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 173114792 |
| Molecular Formula | C16H11F3N4O2S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2,2,2-trifluoroethoxy)quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\NC(=O)C\S1=C\c1ccc2ncc(C#N)c(OCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C16H11F3N4O2S/c17-16(18,19)8-25-14-10(4-20)5-22-12-2-1-9(3-11(12)14)6-26-7-13(24)23-15(26)21/h1-3,5-6H,7-8H2,(H2,21,23,24) |
| InChIKey | JAZFTRGDXRERFS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|