About N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide
N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide (PubChem CID 173114828) has the molecular formula C11H15F2N3O2
and a molecular weight of 259.26 g/mol. Its IUPAC name is N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide.
Molecular Properties
| Compound Name | N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide |
| PubChem CID | 173114828 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide |
| SMILES | N#CC1(NC(=O)CCC(F)(F)CCC(N)=O)CC1 |
| InChI | InChI=1S/C11H15F2N3O2/c12-11(13,3-1-8(15)17)4-2-9(18)16-10(7-14)5-6-10/h1-6H2,(H2,15,17)(H,16,18) |
| InChIKey | VEOMNCABIYFVLZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide?
The IUPAC name of N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide (CID 173114828) is N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide.
What is the SMILES notation for N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide?
The canonical SMILES for N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide is N#CC1(NC(=O)CCC(F)(F)CCC(N)=O)CC1.
What is the InChIKey of N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide?
The InChIKey is VEOMNCABIYFVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3O2/c12-11(13,3-1-8(15)17)4-2-9(18)16-10(7-14)5-6-10/h1-6H2,(H2,15,17)(H,16,18).
What are the key properties of N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide?
N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide has a molecular weight of 259.26 g/mol, XLogP of 0.84, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyanocyclopropyl)-4,4-difluoroheptanediamide is sourced from PubChem (CID 173114828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).