C29H38N2NaO7S2+ — CID 173115190
sodium;[4-(4-anilinobuta-1,3-dienyl)-2-tert-butylchromen-7-ylidene]-bis(3-sulfopropyl)azanium;hydride (PubChem CID 173115190) has the molecular formula C29H38N2NaO7S2+ and a molecular weight of 613.75 g/mol. Its IUPAC name is sodium;[4-(4-anilinobuta-1,3-dienyl)-2-tert-butylchromen-7-ylidene]-bis(3-sulfopropyl)azanium;hydride.
| Compound Name | sodium;[4-(4-anilinobuta-1,3-dienyl)-2-tert-butylchromen-7-ylidene]-bis(3-sulfopropyl)azanium;hydride |
|---|---|
| PubChem CID | 173115190 |
| Molecular Formula | C29H38N2NaO7S2+ |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | sodium;[4-(4-anilinobuta-1,3-dienyl)-2-tert-butylchromen-7-ylidene]-bis(3-sulfopropyl)azanium;hydride |
| SMILES | CC(C)(C)c1cc(C=CC=CNc2ccccc2)c2ccc(=[N+](CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc-2o1.[H-].[Na+] |
| InChI | InChI=1S/C29H36N2O7S2.Na.H/c1-29(2,3)28-21-23(11-7-8-16-30-24-12-5-4-6-13-24)26-15-14-25(22-27(26)38-28)31(17-9-19-39(32,33)34)18-10-20-40(35,36)37;;/h4-8,11-16,21-22H,9-10,17-20H2,1-3H3,(H2,32,33,34,35,36,37);;/q;+1;-1/p+1 |
| InChIKey | GRFVFEMHCCEIQH-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|