C20H25FN4O3 — CID 173115388
[8-(cyclobutylmethyl)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamic acid (PubChem CID 173115388) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is [8-(cyclobutylmethyl)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamic acid.
| Compound Name | [8-(cyclobutylmethyl)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamic acid |
|---|---|
| PubChem CID | 173115388 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [8-(cyclobutylmethyl)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamic acid |
| SMILES | CC1CC2(CCN1CC1CCC1)C(=NC(=O)O)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C20H25FN4O3/c1-13-11-20(8-9-24(13)12-14-4-2-5-14)17(23-19(27)28)22-18(26)25(20)16-7-3-6-15(21)10-16/h3,6-7,10,13-14H,2,4-5,8-9,11-12H2,1H3,(H,27,28)(H,22,23,26) |
| InChIKey | VBBYYWLEANTWNF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|