About sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate
sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate (PubChem CID 173115689) has the molecular formula C7H7NNaO4PS
and a molecular weight of 255.17 g/mol. Its IUPAC name is sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate |
| PubChem CID | 173115689 |
| Molecular Formula | C7H7NNaO4PS |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1ccc(N=C=S)cc1.[H-].[Na+] |
| InChI | InChI=1S/C7H6NO4PS.Na.H/c9-13(10,11)12-7-3-1-6(2-4-7)8-5-14;;/h1-4H,(H2,9,10,11);;/q;+1;-1 |
| InChIKey | XRQHUEMTDALHDA-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate?
The IUPAC name of sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate (CID 173115689) is sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate.
What is the SMILES notation for sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate?
The canonical SMILES for sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate is O=P(O)(O)Oc1ccc(N=C=S)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate?
The InChIKey is XRQHUEMTDALHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NO4PS.Na.H/c9-13(10,11)12-7-3-1-6(2-4-7)8-5-14;;/h1-4H,(H2,9,10,11);;/q;+1;-1.
What are the key properties of sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate?
sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate has a molecular weight of 255.17 g/mol, XLogP of -0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(4-isothiocyanatophenyl) dihydrogen phosphate is sourced from PubChem (CID 173115689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).