About lithium;hydride;S-triethoxysilyl ethanethioate
lithium;hydride;S-triethoxysilyl ethanethioate (PubChem CID 173116064) has the molecular formula C8H19LiO4SSi
and a molecular weight of 246.33 g/mol. Its IUPAC name is lithium;hydride;S-triethoxysilyl ethanethioate.
Molecular Properties
| Compound Name | lithium;hydride;S-triethoxysilyl ethanethioate |
| PubChem CID | 173116064 |
| Molecular Formula | C8H19LiO4SSi |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | lithium;hydride;S-triethoxysilyl ethanethioate |
| SMILES | CCO[Si](OCC)(OCC)SC(C)=O.[H-].[Li+] |
| InChI | InChI=1S/C8H18O4SSi.Li.H/c1-5-10-14(11-6-2,12-7-3)13-8(4)9;;/h5-7H2,1-4H3;;/q;+1;-1 |
| InChIKey | ZAKGKSLKIZGIFQ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;S-triethoxysilyl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;S-triethoxysilyl ethanethioate?
The IUPAC name of lithium;hydride;S-triethoxysilyl ethanethioate (CID 173116064) is lithium;hydride;S-triethoxysilyl ethanethioate.
What is the SMILES notation for lithium;hydride;S-triethoxysilyl ethanethioate?
The canonical SMILES for lithium;hydride;S-triethoxysilyl ethanethioate is CCO[Si](OCC)(OCC)SC(C)=O.[H-].[Li+].
What is the InChIKey of lithium;hydride;S-triethoxysilyl ethanethioate?
The InChIKey is ZAKGKSLKIZGIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O4SSi.Li.H/c1-5-10-14(11-6-2,12-7-3)13-8(4)9;;/h5-7H2,1-4H3;;/q;+1;-1.
What are the key properties of lithium;hydride;S-triethoxysilyl ethanethioate?
lithium;hydride;S-triethoxysilyl ethanethioate has a molecular weight of 246.33 g/mol, XLogP of -1.07, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;S-triethoxysilyl ethanethioate is sourced from PubChem (CID 173116064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).