C19H33NO4Si — CID 173116480
(2S,3S,4S,5R)-5-(benzylamino)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxane-3,4-diol (PubChem CID 173116480) has the molecular formula C19H33NO4Si and a molecular weight of 367.56 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-(benzylamino)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-5-(benzylamino)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 173116480 |
| Molecular Formula | C19H33NO4Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | (2S,3S,4S,5R)-5-(benzylamino)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxane-3,4-diol |
| SMILES | C[SiH](C)OC([C@H]1OC[C@@H](NCc2ccccc2)[C@H](O)[C@@H]1O)C(C)(C)C |
| InChI | InChI=1S/C19H33NO4Si/c1-19(2,3)18(24-25(4)5)17-16(22)15(21)14(12-23-17)20-11-13-9-7-6-8-10-13/h6-10,14-18,20-22,25H,11-12H2,1-5H3/t14-,15+,16+,17+,18?/m1/s1 |
| InChIKey | PFLOWAYQRATKEB-CBMYITMBSA-N |
| XLogP | 1.68 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|