C24H45FO5Si — CID 173116703
[1-fluorobutyl(dimethyl)silyl] 4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienoate (PubChem CID 173116703) has the molecular formula C24H45FO5Si and a molecular weight of 460.70 g/mol. Its IUPAC name is [1-fluorobutyl(dimethyl)silyl] 4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienoate.
| Compound Name | [1-fluorobutyl(dimethyl)silyl] 4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienoate |
|---|---|
| PubChem CID | 173116703 |
| Molecular Formula | C24H45FO5Si |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | [1-fluorobutyl(dimethyl)silyl] 4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienoate |
| SMILES | C=CC(CC(C)=CC(C)C(OC)C(CC(C)C(=O)O[Si](C)(C)C(F)CCC)OC)OC |
| InChI | InChI=1S/C24H45FO5Si/c1-11-13-22(25)31(9,10)30-24(26)19(5)16-21(28-7)23(29-8)18(4)14-17(3)15-20(12-2)27-6/h12,14,18-23H,2,11,13,15-16H2,1,3-10H3 |
| InChIKey | DXFOLKHASJJTCR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|