About 1-fluoropropan-1-amine;hydrochloride
1-fluoropropan-1-amine;hydrochloride (PubChem CID 173116737) has the molecular formula C3H9ClFN
and a molecular weight of 113.56 g/mol. Its IUPAC name is 1-fluoropropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-fluoropropan-1-amine;hydrochloride |
| PubChem CID | 173116737 |
| Molecular Formula | C3H9ClFN |
| Molecular Weight | 113.56 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | 1-fluoropropan-1-amine;hydrochloride |
| SMILES | CCC(N)F.Cl |
| InChI | InChI=1S/C3H8FN.ClH/c1-2-3(4)5;/h3H,2,5H2,1H3;1H |
| InChIKey | GSTLQWHHRIREGF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoropropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropropan-1-amine;hydrochloride?
The IUPAC name of 1-fluoropropan-1-amine;hydrochloride (CID 173116737) is 1-fluoropropan-1-amine;hydrochloride.
What is the SMILES notation for 1-fluoropropan-1-amine;hydrochloride?
The canonical SMILES for 1-fluoropropan-1-amine;hydrochloride is CCC(N)F.Cl.
What is the InChIKey of 1-fluoropropan-1-amine;hydrochloride?
The InChIKey is GSTLQWHHRIREGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8FN.ClH/c1-2-3(4)5;/h3H,2,5H2,1H3;1H.
What are the key properties of 1-fluoropropan-1-amine;hydrochloride?
1-fluoropropan-1-amine;hydrochloride has a molecular weight of 113.56 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropropan-1-amine;hydrochloride is sourced from PubChem (CID 173116737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).