About N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide
N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide (PubChem CID 173117117) has the molecular formula C6H8N4O4S
and a molecular weight of 232.22 g/mol. Its IUPAC name is N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 173117117 |
| Molecular Formula | C6H8N4O4S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(N=C1NOCCO1)c1cn[nH]c1 |
| InChI | InChI=1S/C6H8N4O4S/c11-15(12,5-3-7-8-4-5)10-6-9-14-2-1-13-6/h3-4H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | YOCVKJRLODPDRO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide (CID 173117117) is N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide is O=S(=O)(N=C1NOCCO1)c1cn[nH]c1.
What is the InChIKey of N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide?
The InChIKey is YOCVKJRLODPDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4S/c11-15(12,5-3-7-8-4-5)10-6-9-14-2-1-13-6/h3-4H,1-2H2,(H,7,8)(H,9,10).
What are the key properties of N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide?
N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide has a molecular weight of 232.22 g/mol, XLogP of -0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4,2-dioxazinan-3-ylidene)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 173117117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).