About 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium
1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium (PubChem CID 173117449) has the molecular formula C16H24Ru
and a molecular weight of 317.44 g/mol. Its IUPAC name is 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium.
Molecular Properties
| Compound Name | 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium |
| PubChem CID | 173117449 |
| Molecular Formula | C16H24Ru |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium |
| SMILES | C=C(C)CC1=C(CC(=C)C)CCC=CCC1.[Ru] |
| InChI | InChI=1S/C16H24.Ru/c1-13(2)11-15-9-7-5-6-8-10-16(15)12-14(3)4;/h5-6H,1,3,7-12H2,2,4H3; |
| InChIKey | ORGUNVVHRJJMKX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium?
The IUPAC name of 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium (CID 173117449) is 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium.
What is the SMILES notation for 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium?
The canonical SMILES for 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium is C=C(C)CC1=C(CC(=C)C)CCC=CCC1.[Ru].
What is the InChIKey of 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium?
The InChIKey is ORGUNVVHRJJMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24.Ru/c1-13(2)11-15-9-7-5-6-8-10-16(15)12-14(3)4;/h5-6H,1,3,7-12H2,2,4H3;.
What are the key properties of 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium?
1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium has a molecular weight of 317.44 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2-methylprop-2-enyl)cycloocta-1,5-diene;ruthenium is sourced from PubChem (CID 173117449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).