About 1-methylacridine;nitric acid
1-methylacridine;nitric acid (PubChem CID 173117700) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-methylacridine;nitric acid.
Molecular Properties
| Compound Name | 1-methylacridine;nitric acid |
| PubChem CID | 173117700 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-methylacridine;nitric acid |
| SMILES | Cc1cccc2nc3ccccc3cc12.O=[N+]([O-])O |
| InChI | InChI=1S/C14H11N.HNO3/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14;2-1(3)4/h2-9H,1H3;(H,2,3,4) |
| InChIKey | VPBMJFIPPLXKPG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylacridine;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylacridine;nitric acid?
The IUPAC name of 1-methylacridine;nitric acid (CID 173117700) is 1-methylacridine;nitric acid.
What is the SMILES notation for 1-methylacridine;nitric acid?
The canonical SMILES for 1-methylacridine;nitric acid is Cc1cccc2nc3ccccc3cc12.O=[N+]([O-])O.
What is the InChIKey of 1-methylacridine;nitric acid?
The InChIKey is VPBMJFIPPLXKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.HNO3/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14;2-1(3)4/h2-9H,1H3;(H,2,3,4).
What are the key properties of 1-methylacridine;nitric acid?
1-methylacridine;nitric acid has a molecular weight of 256.26 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylacridine;nitric acid is sourced from PubChem (CID 173117700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).