About potassium;2,4-dichloro-1,3,5-triazine;hydride
potassium;2,4-dichloro-1,3,5-triazine;hydride (PubChem CID 173118138) has the molecular formula C3H2Cl2KN3
and a molecular weight of 190.07 g/mol. Its IUPAC name is potassium;2,4-dichloro-1,3,5-triazine;hydride.
Molecular Properties
| Compound Name | potassium;2,4-dichloro-1,3,5-triazine;hydride |
| PubChem CID | 173118138 |
| Molecular Formula | C3H2Cl2KN3 |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 188.93 |
| IUPAC Name | potassium;2,4-dichloro-1,3,5-triazine;hydride |
| SMILES | Clc1ncnc(Cl)n1.[H-].[K+] |
| InChI | InChI=1S/C3HCl2N3.K.H/c4-2-6-1-7-3(5)8-2;;/h1H;;/q;+1;-1 |
| InChIKey | NUEHDWKGEYAZJL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;2,4-dichloro-1,3,5-triazine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2,4-dichloro-1,3,5-triazine;hydride?
The IUPAC name of potassium;2,4-dichloro-1,3,5-triazine;hydride (CID 173118138) is potassium;2,4-dichloro-1,3,5-triazine;hydride.
What is the SMILES notation for potassium;2,4-dichloro-1,3,5-triazine;hydride?
The canonical SMILES for potassium;2,4-dichloro-1,3,5-triazine;hydride is Clc1ncnc(Cl)n1.[H-].[K+].
What is the InChIKey of potassium;2,4-dichloro-1,3,5-triazine;hydride?
The InChIKey is NUEHDWKGEYAZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HCl2N3.K.H/c4-2-6-1-7-3(5)8-2;;/h1H;;/q;+1;-1.
What are the key properties of potassium;2,4-dichloro-1,3,5-triazine;hydride?
potassium;2,4-dichloro-1,3,5-triazine;hydride has a molecular weight of 190.07 g/mol, XLogP of -1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2,4-dichloro-1,3,5-triazine;hydride is sourced from PubChem (CID 173118138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).